C11H9N5O — CID 21152599
1-cyano-2-(furan-2-yl)-3-pyridin-3-ylguanidine (PubChem CID 21152599) has the molecular formula C11H9N5O and a molecular weight of 227.23 g/mol. Its IUPAC name is 1-cyano-2-(furan-2-yl)-3-pyridin-3-ylguanidine.
| Compound Name | 1-cyano-2-(furan-2-yl)-3-pyridin-3-ylguanidine |
|---|---|
| PubChem CID | 21152599 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-cyano-2-(furan-2-yl)-3-pyridin-3-ylguanidine |
| SMILES | N#CN/C(=N/c1ccco1)Nc1cccnc1 |
| InChI | InChI=1S/C11H9N5O/c12-8-14-11(16-10-4-2-6-17-10)15-9-3-1-5-13-7-9/h1-7H,(H2,14,15,16) |
| InChIKey | PZKBYBUTYHHISJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|