C26H25ClN6O2S — CID 123433926
1-(1,1a-dihydroazirino[1,2-a]quinolin-4-yl)-3-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea (PubChem CID 123433926) has the molecular formula C26H25ClN6O2S and a molecular weight of 521.05 g/mol. Its IUPAC name is 1-(1,1a-dihydroazirino[1,2-a]quinolin-4-yl)-3-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea.
| Compound Name | 1-(1,1a-dihydroazirino[1,2-a]quinolin-4-yl)-3-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 123433926 |
| Molecular Formula | C26H25ClN6O2S |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 1-(1,1a-dihydroazirino[1,2-a]quinolin-4-yl)-3-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea |
| SMILES | CSc1c(Cl)nc(-c2ccc(NC(=O)Nc3cccc4c3C=CC3CN43)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C26H25ClN6O2S/c1-36-22-23(27)30-24(31-25(22)32-11-13-35-14-12-32)16-5-7-17(8-6-16)28-26(34)29-20-3-2-4-21-19(20)10-9-18-15-33(18)21/h2-10,18H,11-15H2,1H3,(H2,28,29,34) |
| InChIKey | AIZNIARZRWDDQH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|