C17H18N4O — CID 42635323
4-[2-(3-methylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]morpholine (PubChem CID 42635323) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-[2-(3-methylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-(3-methylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 42635323 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-[2-(3-methylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]morpholine |
| SMILES | Cc1cccc(-c2nc(N3CCOCC3)c3[nH]ccc3n2)c1 |
| InChI | InChI=1S/C17H18N4O/c1-12-3-2-4-13(11-12)16-19-14-5-6-18-15(14)17(20-16)21-7-9-22-10-8-21/h2-6,11,18H,7-10H2,1H3 |
| InChIKey | QCZLVMRYXDKNES-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |