C17H20N6O3 — CID 45493316
N-(3,4-dimethoxyphenyl)-6-morpholin-4-yl-7H-purin-2-amine (PubChem CID 45493316) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-morpholin-4-yl-7H-purin-2-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-morpholin-4-yl-7H-purin-2-amine |
|---|---|
| PubChem CID | 45493316 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-morpholin-4-yl-7H-purin-2-amine |
| SMILES | COc1ccc(Nc2nc(N3CCOCC3)c3[nH]cnc3n2)cc1OC |
| InChI | InChI=1S/C17H20N6O3/c1-24-12-4-3-11(9-13(12)25-2)20-17-21-15-14(18-10-19-15)16(22-17)23-5-7-26-8-6-23/h3-4,9-10H,5-8H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | HQTWCSJFLUYOJR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |