C21H19F2N7O — CID 10410037
2-N,8-N-bis(3-fluorophenyl)-6-morpholin-4-yl-7H-purine-2,8-diamine (PubChem CID 10410037) has the molecular formula C21H19F2N7O and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-N,8-N-bis(3-fluorophenyl)-6-morpholin-4-yl-7H-purine-2,8-diamine.
| Compound Name | 2-N,8-N-bis(3-fluorophenyl)-6-morpholin-4-yl-7H-purine-2,8-diamine |
|---|---|
| PubChem CID | 10410037 |
| Molecular Formula | C21H19F2N7O |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-N,8-N-bis(3-fluorophenyl)-6-morpholin-4-yl-7H-purine-2,8-diamine |
| SMILES | Fc1cccc(Nc2nc(N3CCOCC3)c3[nH]c(Nc4cccc(F)c4)nc3n2)c1 |
| InChI | InChI=1S/C21H19F2N7O/c22-13-3-1-5-15(11-13)24-20-26-17-18(27-20)28-21(25-16-6-2-4-14(23)12-16)29-19(17)30-7-9-31-10-8-30/h1-6,11-12H,7-10H2,(H3,24,25,26,27,28,29) |
| InChIKey | ZKGFNXMQJCQBCG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |