C22H25N9O — CID 25060894
8-methyl-N-(4-morpholin-4-ylphenyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-7H-purin-2-amine (PubChem CID 25060894) has the molecular formula C22H25N9O and a molecular weight of 431.50 g/mol. Its IUPAC name is 8-methyl-N-(4-morpholin-4-ylphenyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-7H-purin-2-amine.
| Compound Name | 8-methyl-N-(4-morpholin-4-ylphenyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 25060894 |
| Molecular Formula | C22H25N9O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 8-methyl-N-(4-morpholin-4-ylphenyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-7H-purin-2-amine |
| SMILES | Cc1nc2nc(Nc3ccc(N4CCOCC4)cc3)nc(N3CCc4nc[nH]c4C3)c2[nH]1 |
| InChI | InChI=1S/C22H25N9O/c1-14-25-19-20(26-14)28-22(29-21(19)31-7-6-17-18(12-31)24-13-23-17)27-15-2-4-16(5-3-15)30-8-10-32-11-9-30/h2-5,13H,6-12H2,1H3,(H,23,24)(H2,25,26,27,28,29) |
| InChIKey | FQDGQLDUQURWFE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|