C24H28N8O2 — CID 174597339
1-[methyl-[5-[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]-2-pyridinyl]amino]propan-2-ol (PubChem CID 174597339) has the molecular formula C24H28N8O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 1-[methyl-[5-[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]-2-pyridinyl]amino]propan-2-ol.
| Compound Name | 1-[methyl-[5-[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]-2-pyridinyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 174597339 |
| Molecular Formula | C24H28N8O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-[methyl-[5-[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]-2-pyridinyl]amino]propan-2-ol |
| SMILES | CC(O)CN(C)c1ccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)nc3nc[nH]c23)cn1 |
| InChI | InChI=1S/C24H28N8O2/c1-16(33)14-31(2)20-8-3-17(13-25-20)21-22-23(27-15-26-22)30-24(29-21)28-18-4-6-19(7-5-18)32-9-11-34-12-10-32/h3-8,13,15-16,33H,9-12,14H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | ZSBUIYDAWNTKHJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|