C22H28N8O2 — CID 59160532
1-[4-[[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]amino]piperidin-1-yl]ethanone (PubChem CID 59160532) has the molecular formula C22H28N8O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-[4-[[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 59160532 |
| Molecular Formula | C22H28N8O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[4-[[2-(4-morpholin-4-ylanilino)-7H-purin-6-yl]amino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Nc2nc(Nc3ccc(N4CCOCC4)cc3)nc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C22H28N8O2/c1-15(31)29-8-6-17(7-9-29)25-21-19-20(24-14-23-19)27-22(28-21)26-16-2-4-18(5-3-16)30-10-12-32-13-11-30/h2-5,14,17H,6-13H2,1H3,(H3,23,24,25,26,27,28) |
| InChIKey | GJNWFWANPOBGRK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|