C22H19F2N5O — CID 24889684
5-fluoro-4-(5-fluoro-1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 24889684) has the molecular formula C22H19F2N5O and a molecular weight of 407.42 g/mol. Its IUPAC name is 5-fluoro-4-(5-fluoro-1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(5-fluoro-1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 24889684 |
| Molecular Formula | C22H19F2N5O |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 5-fluoro-4-(5-fluoro-1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | Fc1ccc2[nH]cc(-c3nc(Nc4ccc(N5CCOCC5)cc4)ncc3F)c2c1 |
| InChI | InChI=1S/C22H19F2N5O/c23-14-1-6-20-17(11-14)18(12-25-20)21-19(24)13-26-22(28-21)27-15-2-4-16(5-3-15)29-7-9-30-10-8-29/h1-6,11-13,25H,7-10H2,(H,26,27,28) |
| InChIKey | ZIPCLOZULPHHRT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|