C14H14F2N4O — CID 172590955
N,5-difluoro-4-(3-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 172590955) has the molecular formula C14H14F2N4O and a molecular weight of 292.29 g/mol. Its IUPAC name is N,5-difluoro-4-(3-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | N,5-difluoro-4-(3-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 172590955 |
| Molecular Formula | C14H14F2N4O |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N,5-difluoro-4-(3-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | FNc1ncc(F)c(-c2cccc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C14H14F2N4O/c15-12-9-17-14(19-16)18-13(12)10-2-1-3-11(8-10)20-4-6-21-7-5-20/h1-3,8-9H,4-7H2,(H,17,18,19) |
| InChIKey | VOVNFSMJDKXFBF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|