C13H10F2N4O2 — CID 172591924
3-[3-[5-fluoro-2-(fluoroamino)pyrimidin-4-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 172591924) has the molecular formula C13H10F2N4O2 and a molecular weight of 292.25 g/mol. Its IUPAC name is 3-[3-[5-fluoro-2-(fluoroamino)pyrimidin-4-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-[5-fluoro-2-(fluoroamino)pyrimidin-4-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 172591924 |
| Molecular Formula | C13H10F2N4O2 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-[3-[5-fluoro-2-(fluoroamino)pyrimidin-4-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cccc(-c2nc(NF)ncc2F)c1 |
| InChI | InChI=1S/C13H10F2N4O2/c14-10-7-16-12(18-15)17-11(10)8-2-1-3-9(6-8)19-4-5-21-13(19)20/h1-3,6-7H,4-5H2,(H,16,17,18) |
| InChIKey | FIFPTHOIACXQDM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|