C27H26FN5O7 — CID 172591870
[4-[[5-fluoro-4-[3-(3-oxomorpholin-4-yl)phenyl]pyrimidin-2-yl]amino]cyclohexyl] (4-nitrophenyl) carbonate (PubChem CID 172591870) has the molecular formula C27H26FN5O7 and a molecular weight of 551.53 g/mol. Its IUPAC name is [4-[[5-fluoro-4-[3-(3-oxomorpholin-4-yl)phenyl]pyrimidin-2-yl]amino]cyclohexyl] (4-nitrophenyl) carbonate.
| Compound Name | [4-[[5-fluoro-4-[3-(3-oxomorpholin-4-yl)phenyl]pyrimidin-2-yl]amino]cyclohexyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 172591870 |
| Molecular Formula | C27H26FN5O7 |
| Molecular Weight | 551.53 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | [4-[[5-fluoro-4-[3-(3-oxomorpholin-4-yl)phenyl]pyrimidin-2-yl]amino]cyclohexyl] (4-nitrophenyl) carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)OC1CCC(Nc2ncc(F)c(-c3cccc(N4CCOCC4=O)c3)n2)CC1 |
| InChI | InChI=1S/C27H26FN5O7/c28-23-15-29-26(31-25(23)17-2-1-3-20(14-17)32-12-13-38-16-24(32)34)30-18-4-8-21(9-5-18)39-27(35)40-22-10-6-19(7-11-22)33(36)37/h1-3,6-7,10-11,14-15,18,21H,4-5,8-9,12-13,16H2,(H,29,30,31) |
| InChIKey | XVFZFXKOZWENTH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 146.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|