C22H21FN6OS — CID 156576295
5-fluoro-N-[4-(1-imino-1-oxo-1,4-thiazinan-4-yl)phenyl]-4-(1H-indol-3-yl)pyrimidin-2-amine (PubChem CID 156576295) has the molecular formula C22H21FN6OS and a molecular weight of 436.52 g/mol. Its IUPAC name is 5-fluoro-N-[4-(1-imino-1-oxo-1,4-thiazinan-4-yl)phenyl]-4-(1H-indol-3-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[4-(1-imino-1-oxo-1,4-thiazinan-4-yl)phenyl]-4-(1H-indol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 156576295 |
| Molecular Formula | C22H21FN6OS |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-fluoro-N-[4-(1-imino-1-oxo-1,4-thiazinan-4-yl)phenyl]-4-(1H-indol-3-yl)pyrimidin-2-amine |
| SMILES | [H]N=S1(=O)CCN(c2ccc(Nc3ncc(F)c(-c4c[nH]c5ccccc45)n3)cc2)CC1 |
| InChI | InChI=1S/C22H21FN6OS/c23-19-14-26-22(28-21(19)18-13-25-20-4-2-1-3-17(18)20)27-15-5-7-16(8-6-15)29-9-11-31(24,30)12-10-29/h1-8,13-14,24-25H,9-12H2,(H,26,27,28) |
| InChIKey | FTJSGLLJRDLVJD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|