C24H24N6O — CID 69074430
1-[1-[4-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]piperazin-2-yl]ethanone (PubChem CID 69074430) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is 1-[1-[4-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]piperazin-2-yl]ethanone.
| Compound Name | 1-[1-[4-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 69074430 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[1-[4-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]piperazin-2-yl]ethanone |
| SMILES | CC(=O)C1CNCCN1c1ccc(Nc2nccc(-c3c[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C24H24N6O/c1-16(31)23-15-25-12-13-30(23)18-8-6-17(7-9-18)28-24-26-11-10-22(29-24)20-14-27-21-5-3-2-4-19(20)21/h2-11,14,23,25,27H,12-13,15H2,1H3,(H,26,28,29) |
| InChIKey | TWXIBXKCRPQGER-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |