C18H22N8 — CID 145496997
N-[3-methyl-4-(methylideneamino)phenyl]-6-(4-methylpiperazin-1-yl)-7H-purin-2-amine (PubChem CID 145496997) has the molecular formula C18H22N8 and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[3-methyl-4-(methylideneamino)phenyl]-6-(4-methylpiperazin-1-yl)-7H-purin-2-amine.
| Compound Name | N-[3-methyl-4-(methylideneamino)phenyl]-6-(4-methylpiperazin-1-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 145496997 |
| Molecular Formula | C18H22N8 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[3-methyl-4-(methylideneamino)phenyl]-6-(4-methylpiperazin-1-yl)-7H-purin-2-amine |
| SMILES | C=Nc1ccc(Nc2nc(N3CCN(C)CC3)c3[nH]cnc3n2)cc1C |
| InChI | InChI=1S/C18H22N8/c1-12-10-13(4-5-14(12)19-2)22-18-23-16-15(20-11-21-16)17(24-18)26-8-6-25(3)7-9-26/h4-5,10-11H,2,6-9H2,1,3H3,(H2,20,21,22,23,24) |
| InChIKey | APMJBRVGYVDMBL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|