C12H15F3N6 — CID 75460800
6-(4-methyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine (PubChem CID 75460800) has the molecular formula C12H15F3N6 and a molecular weight of 300.29 g/mol. Its IUPAC name is 6-(4-methyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine.
| Compound Name | 6-(4-methyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine |
|---|---|
| PubChem CID | 75460800 |
| Molecular Formula | C12H15F3N6 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 6-(4-methyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine |
| SMILES | CN1CCCN(c2nc(C(F)(F)F)nc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C12H15F3N6/c1-20-3-2-4-21(6-5-20)10-8-9(17-7-16-8)18-11(19-10)12(13,14)15/h7H,2-6H2,1H3,(H,16,17,18,19) |
| InChIKey | VHANERUDABCCEK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |