C14H13F3N8 — CID 119049633
6-(4-pyridazin-3-ylpiperazin-1-yl)-2-(trifluoromethyl)-7H-purine (PubChem CID 119049633) has the molecular formula C14H13F3N8 and a molecular weight of 350.31 g/mol. Its IUPAC name is 6-(4-pyridazin-3-ylpiperazin-1-yl)-2-(trifluoromethyl)-7H-purine.
| Compound Name | 6-(4-pyridazin-3-ylpiperazin-1-yl)-2-(trifluoromethyl)-7H-purine |
|---|---|
| PubChem CID | 119049633 |
| Molecular Formula | C14H13F3N8 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 6-(4-pyridazin-3-ylpiperazin-1-yl)-2-(trifluoromethyl)-7H-purine |
| SMILES | FC(F)(F)c1nc(N2CCN(c3cccnn3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H13F3N8/c15-14(16,17)13-21-11-10(18-8-19-11)12(22-13)25-6-4-24(5-7-25)9-2-1-3-20-23-9/h1-3,8H,4-7H2,(H,18,19,21,22) |
| InChIKey | VBXXCNFPTOYKLT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |