C13H14F3N5O — CID 138992024
7-[2-(trifluoromethyl)-7H-purin-6-yl]-1-oxa-7-azaspiro[3.5]nonane (PubChem CID 138992024) has the molecular formula C13H14F3N5O and a molecular weight of 313.28 g/mol. Its IUPAC name is 7-[2-(trifluoromethyl)-7H-purin-6-yl]-1-oxa-7-azaspiro[3.5]nonane.
| Compound Name | 7-[2-(trifluoromethyl)-7H-purin-6-yl]-1-oxa-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 138992024 |
| Molecular Formula | C13H14F3N5O |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 7-[2-(trifluoromethyl)-7H-purin-6-yl]-1-oxa-7-azaspiro[3.5]nonane |
| SMILES | FC(F)(F)c1nc(N2CCC3(CCO3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H14F3N5O/c14-13(15,16)11-19-9-8(17-7-18-9)10(20-11)21-4-1-12(2-5-21)3-6-22-12/h7H,1-6H2,(H,17,18,19,20) |
| InChIKey | JOCBDHZBIZKJCK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |