C15H15F3N8 — CID 131963286
6-(4-pyridazin-3-yl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine (PubChem CID 131963286) has the molecular formula C15H15F3N8 and a molecular weight of 364.34 g/mol. Its IUPAC name is 6-(4-pyridazin-3-yl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine.
| Compound Name | 6-(4-pyridazin-3-yl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine |
|---|---|
| PubChem CID | 131963286 |
| Molecular Formula | C15H15F3N8 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 6-(4-pyridazin-3-yl-1,4-diazepan-1-yl)-2-(trifluoromethyl)-7H-purine |
| SMILES | FC(F)(F)c1nc(N2CCCN(c3cccnn3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C15H15F3N8/c16-15(17,18)14-22-12-11(19-9-20-12)13(23-14)26-6-2-5-25(7-8-26)10-3-1-4-21-24-10/h1,3-4,9H,2,5-8H2,(H,19,20,22,23) |
| InChIKey | SFLCJJFJPDQPMY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |