C15H15N9 — CID 163350765
6-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]pyridazine-3-carbonitrile (PubChem CID 163350765) has the molecular formula C15H15N9 and a molecular weight of 321.35 g/mol. Its IUPAC name is 6-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]pyridazine-3-carbonitrile.
| Compound Name | 6-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 163350765 |
| Molecular Formula | C15H15N9 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 6-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCCN(c3ncnc4nc[nH]c34)CC2)nn1 |
| InChI | InChI=1S/C15H15N9/c16-8-11-2-3-12(22-21-11)23-4-1-5-24(7-6-23)15-13-14(18-9-17-13)19-10-20-15/h2-3,9-10H,1,4-7H2,(H,17,18,19,20) |
| InChIKey | YAKGEJHQLXAFLX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |