C13H17N7 — CID 63343521
2-methyl-2-[4-(7H-purin-6-yl)piperazin-1-yl]propanenitrile (PubChem CID 63343521) has the molecular formula C13H17N7 and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-methyl-2-[4-(7H-purin-6-yl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-methyl-2-[4-(7H-purin-6-yl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 63343521 |
| Molecular Formula | C13H17N7 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-methyl-2-[4-(7H-purin-6-yl)piperazin-1-yl]propanenitrile |
| SMILES | CC(C)(C#N)N1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C13H17N7/c1-13(2,7-14)20-5-3-19(4-6-20)12-10-11(16-8-15-10)17-9-18-12/h8-9H,3-6H2,1-2H3,(H,15,16,17,18) |
| InChIKey | BKFVVFQKNABSRL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |