C16H16F3N7 — CID 119041060
6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)-7H-purine (PubChem CID 119041060) has the molecular formula C16H16F3N7 and a molecular weight of 363.35 g/mol. Its IUPAC name is 6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)-7H-purine.
| Compound Name | 6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)-7H-purine |
|---|---|
| PubChem CID | 119041060 |
| Molecular Formula | C16H16F3N7 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)-7H-purine |
| SMILES | FC(F)(F)c1nc(N2CCN(Cc3cccnc3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C16H16F3N7/c17-16(18,19)15-23-13-12(21-10-22-13)14(24-15)26-6-4-25(5-7-26)9-11-2-1-3-20-8-11/h1-3,8,10H,4-7,9H2,(H,21,22,23,24) |
| InChIKey | PSBJUXRZTHTUMR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |