C16H18F3N5 — CID 171326651
2-methyl-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidine (PubChem CID 171326651) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-methyl-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-methyl-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 171326651 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-methyl-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidine |
| SMILES | Cc1nc(N2CCN(Cc3cccnc3)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H18F3N5/c1-12-21-14(16(17,18)19)9-15(22-12)24-7-5-23(6-8-24)11-13-3-2-4-20-10-13/h2-4,9-10H,5-8,11H2,1H3 |
| InChIKey | RKOBHYKEHVVNFB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |