C19H27N5S — CID 163354158
4-tert-butyl-2-methylsulfanyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyrimidine (PubChem CID 163354158) has the molecular formula C19H27N5S and a molecular weight of 357.53 g/mol. Its IUPAC name is 4-tert-butyl-2-methylsulfanyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-tert-butyl-2-methylsulfanyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 163354158 |
| Molecular Formula | C19H27N5S |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 4-tert-butyl-2-methylsulfanyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyrimidine |
| SMILES | CSc1nc(N2CCN(Cc3cccnc3)CC2)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H27N5S/c1-19(2,3)16-12-17(22-18(21-16)25-4)24-10-8-23(9-11-24)14-15-6-5-7-20-13-15/h5-7,12-13H,8-11,14H2,1-4H3 |
| InChIKey | PLRMNUWESSQUHX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |