C14H16F3N5O2 — CID 138999119
4-[2-(trifluoromethyl)-7H-purin-6-yl]-1,8-dioxa-4-azaspiro[5.5]undecane (PubChem CID 138999119) has the molecular formula C14H16F3N5O2 and a molecular weight of 343.31 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)-7H-purin-6-yl]-1,8-dioxa-4-azaspiro[5.5]undecane.
| Compound Name | 4-[2-(trifluoromethyl)-7H-purin-6-yl]-1,8-dioxa-4-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 138999119 |
| Molecular Formula | C14H16F3N5O2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[2-(trifluoromethyl)-7H-purin-6-yl]-1,8-dioxa-4-azaspiro[5.5]undecane |
| SMILES | FC(F)(F)c1nc(N2CCOC3(CCCOC3)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H16F3N5O2/c15-14(16,17)12-20-10-9(18-8-19-10)11(21-12)22-3-5-24-13(6-22)2-1-4-23-7-13/h8H,1-7H2,(H,18,19,20,21) |
| InChIKey | XDASNEPZZKLRPQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |