C15H18F3N5O — CID 128728141
2-(7H-purin-6-yl)-5-(trifluoromethyl)-9-oxa-2-azaspiro[5.5]undecane (PubChem CID 128728141) has the molecular formula C15H18F3N5O and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-(7H-purin-6-yl)-5-(trifluoromethyl)-9-oxa-2-azaspiro[5.5]undecane.
| Compound Name | 2-(7H-purin-6-yl)-5-(trifluoromethyl)-9-oxa-2-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 128728141 |
| Molecular Formula | C15H18F3N5O |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-(7H-purin-6-yl)-5-(trifluoromethyl)-9-oxa-2-azaspiro[5.5]undecane |
| SMILES | FC(F)(F)C1CCN(c2ncnc3nc[nH]c23)CC12CCOCC2 |
| InChI | InChI=1S/C15H18F3N5O/c16-15(17,18)10-1-4-23(7-14(10)2-5-24-6-3-14)13-11-12(20-8-19-11)21-9-22-13/h8-10H,1-7H2,(H,19,20,21,22) |
| InChIKey | PGNRLPALSBLUQS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |