C18H19F3N8 — CID 126890839
N-cyclopropyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 126890839) has the molecular formula C18H19F3N8 and a molecular weight of 404.40 g/mol. Its IUPAC name is N-cyclopropyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 126890839 |
| Molecular Formula | C18H19F3N8 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-cyclopropyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(N(C2CC2)C2CCN(c3ncnc4nc[nH]c34)CC2)ncn1 |
| InChI | InChI=1S/C18H19F3N8/c19-18(20,21)13-7-14(23-8-22-13)29(11-1-2-11)12-3-5-28(6-4-12)17-15-16(25-9-24-15)26-10-27-17/h7-12H,1-6H2,(H,24,25,26,27) |
| InChIKey | VKPRLJXTXQKUCV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |