C18H22N8 — CID 172903790
2-cyclopropyl-N-methyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pyrimidin-4-amine (PubChem CID 172903790) has the molecular formula C18H22N8 and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-cyclopropyl-N-methyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-methyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172903790 |
| Molecular Formula | C18H22N8 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-cyclopropyl-N-methyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pyrimidin-4-amine |
| SMILES | CN(c1ccnc(C2CC2)n1)C1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C18H22N8/c1-25(14-4-7-19-16(24-14)12-2-3-12)13-5-8-26(9-6-13)18-15-17(21-10-20-15)22-11-23-18/h4,7,10-13H,2-3,5-6,8-9H2,1H3,(H,20,21,22,23) |
| InChIKey | WDTWNMHMKSLDLQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |