C15H14ClN5 — CID 104787339
2-(2-chloro-7H-purin-6-yl)-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 104787339) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is 2-(2-chloro-7H-purin-6-yl)-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 2-(2-chloro-7H-purin-6-yl)-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 104787339 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(2-chloro-7H-purin-6-yl)-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | Clc1nc(N2CCCc3ccccc3C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C15H14ClN5/c16-15-19-13-12(17-9-18-13)14(20-15)21-7-3-6-10-4-1-2-5-11(10)8-21/h1-2,4-5,9H,3,6-8H2,(H,17,18,19,20) |
| InChIKey | SQJWQEMLHWGBID-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |