C14H13ClN6 — CID 146153091
4-(2-chloro-7H-purin-6-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine (PubChem CID 146153091) has the molecular formula C14H13ClN6 and a molecular weight of 300.75 g/mol. Its IUPAC name is 4-(2-chloro-7H-purin-6-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 4-(2-chloro-7H-purin-6-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 146153091 |
| Molecular Formula | C14H13ClN6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-(2-chloro-7H-purin-6-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine |
| SMILES | Clc1nc(N2CCNc3ccccc3C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H13ClN6/c15-14-19-12-11(17-8-18-12)13(20-14)21-6-5-16-10-4-2-1-3-9(10)7-21/h1-4,8,16H,5-7H2,(H,17,18,19,20) |
| InChIKey | AZVHPURBCHZRMX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |