C17H18ClN7O — CID 40920875
(3R)-1-(2-chloro-7H-purin-6-yl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 40920875) has the molecular formula C17H18ClN7O and a molecular weight of 371.83 g/mol. Its IUPAC name is (3R)-1-(2-chloro-7H-purin-6-yl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2-chloro-7H-purin-6-yl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 40920875 |
| Molecular Formula | C17H18ClN7O |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (3R)-1-(2-chloro-7H-purin-6-yl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1CCCN(c2nc(Cl)nc3nc[nH]c23)C1 |
| InChI | InChI=1S/C17H18ClN7O/c18-17-23-14-13(21-10-22-14)15(24-17)25-6-2-4-12(9-25)16(26)20-8-11-3-1-5-19-7-11/h1,3,5,7,10,12H,2,4,6,8-9H2,(H,20,26)(H,21,22,23,24)/t12-/m1/s1 |
| InChIKey | GLMPLHIYDWMCCP-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |