C15H14ClN5 — CID 104787392
1-(2-chloro-7H-purin-6-yl)-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 104787392) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is 1-(2-chloro-7H-purin-6-yl)-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 1-(2-chloro-7H-purin-6-yl)-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 104787392 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(2-chloro-7H-purin-6-yl)-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | Clc1nc(N2CCCCc3ccccc32)c2[nH]cnc2n1 |
| InChI | InChI=1S/C15H14ClN5/c16-15-19-13-12(17-9-18-13)14(20-15)21-8-4-3-6-10-5-1-2-7-11(10)21/h1-2,5,7,9H,3-4,6,8H2,(H,17,18,19,20) |
| InChIKey | LVTIWDREHAPMMN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |