C17H19ClN4 — CID 117102250
2-chloro-4-(3,4-dihydro-2H-quinolin-1-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine (PubChem CID 117102250) has the molecular formula C17H19ClN4 and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-chloro-4-(3,4-dihydro-2H-quinolin-1-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine.
| Compound Name | 2-chloro-4-(3,4-dihydro-2H-quinolin-1-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 117102250 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-chloro-4-(3,4-dihydro-2H-quinolin-1-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
| SMILES | Clc1nc2c(c(N3CCCc4ccccc43)n1)CCNCC2 |
| InChI | InChI=1S/C17H19ClN4/c18-17-20-14-8-10-19-9-7-13(14)16(21-17)22-11-3-5-12-4-1-2-6-15(12)22/h1-2,4,6,19H,3,5,7-11H2 |
| InChIKey | MFRAPTDQOLHXKS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|