C14H20N6 — CID 104623737
6-(8-azaspiro[4.5]decan-8-yl)-7H-purin-2-amine (PubChem CID 104623737) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 6-(8-azaspiro[4.5]decan-8-yl)-7H-purin-2-amine.
| Compound Name | 6-(8-azaspiro[4.5]decan-8-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 104623737 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 6-(8-azaspiro[4.5]decan-8-yl)-7H-purin-2-amine |
| SMILES | Nc1nc(N2CCC3(CCCC3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H20N6/c15-13-18-11-10(16-9-17-11)12(19-13)20-7-5-14(6-8-20)3-1-2-4-14/h9H,1-8H2,(H3,15,16,17,18,19) |
| InChIKey | CQSZCSIXKYGCEE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |