C13H19N7O — CID 166212074
1-[4-(2-amino-7H-purin-6-yl)piperazin-1-yl]-2-methylpropan-1-one (PubChem CID 166212074) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[4-(2-amino-7H-purin-6-yl)piperazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-(2-amino-7H-purin-6-yl)piperazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 166212074 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[4-(2-amino-7H-purin-6-yl)piperazin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(c2nc(N)nc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C13H19N7O/c1-8(2)12(21)20-5-3-19(4-6-20)11-9-10(16-7-15-9)17-13(14)18-11/h7-8H,3-6H2,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | ZQUNTPLODYDMPM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |