C16H17N9O3 — CID 18465298
4-(2-amino-7H-purin-6-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 18465298) has the molecular formula C16H17N9O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 4-(2-amino-7H-purin-6-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-amino-7H-purin-6-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 18465298 |
| Molecular Formula | C16H17N9O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-(2-amino-7H-purin-6-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | Nc1nc(N2CCN(C(=O)Nc3ccc([N+](=O)[O-])cc3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C16H17N9O3/c17-15-21-13-12(18-9-19-13)14(22-15)23-5-7-24(8-6-23)16(26)20-10-1-3-11(4-2-10)25(27)28/h1-4,9H,5-8H2,(H,20,26)(H3,17,18,19,21,22) |
| InChIKey | LPYFCRQXKJPVRF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 159.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|