C17H18N8O3S — CID 78116677
4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methyl-N-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 78116677) has the molecular formula C17H18N8O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methyl-N-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methyl-N-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 78116677 |
| Molecular Formula | C17H18N8O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methyl-N-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc([N+](=O)[O-])cc2)CCN1c1nc(N)nc2scnc12 |
| InChI | InChI=1S/C17H18N8O3S/c1-10-8-23(17(26)20-11-2-4-12(5-3-11)25(27)28)6-7-24(10)14-13-15(29-9-19-13)22-16(18)21-14/h2-5,9-10H,6-8H2,1H3,(H,20,26)(H2,18,21,22) |
| InChIKey | HWXFBEJQPLBYHN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 143.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|