C24H23N7O3S — CID 122443947
[4-[[4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methylpiperazine-1-carbonyl]amino]phenyl] benzoate (PubChem CID 122443947) has the molecular formula C24H23N7O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is [4-[[4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methylpiperazine-1-carbonyl]amino]phenyl] benzoate.
| Compound Name | [4-[[4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methylpiperazine-1-carbonyl]amino]phenyl] benzoate |
|---|---|
| PubChem CID | 122443947 |
| Molecular Formula | C24H23N7O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [4-[[4-(5-amino-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)-3-methylpiperazine-1-carbonyl]amino]phenyl] benzoate |
| SMILES | CC1CN(C(=O)Nc2ccc(OC(=O)c3ccccc3)cc2)CCN1c1nc(N)nc2scnc12 |
| InChI | InChI=1S/C24H23N7O3S/c1-15-13-30(11-12-31(15)20-19-21(35-14-26-19)29-23(25)28-20)24(33)27-17-7-9-18(10-8-17)34-22(32)16-5-3-2-4-6-16/h2-10,14-15H,11-13H2,1H3,(H,27,33)(H2,25,28,29) |
| InChIKey | GFQSAHVKDAPDON-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|