C9H9N7O2 — CID 114785546
4-(2-amino-7H-purin-6-yl)piperazine-2,6-dione (PubChem CID 114785546) has the molecular formula C9H9N7O2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 4-(2-amino-7H-purin-6-yl)piperazine-2,6-dione.
| Compound Name | 4-(2-amino-7H-purin-6-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 114785546 |
| Molecular Formula | C9H9N7O2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-(2-amino-7H-purin-6-yl)piperazine-2,6-dione |
| SMILES | Nc1nc(N2CC(=O)NC(=O)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H9N7O2/c10-9-14-7-6(11-3-12-7)8(15-9)16-1-4(17)13-5(18)2-16/h3H,1-2H2,(H,13,17,18)(H3,10,11,12,14,15) |
| InChIKey | LTVISKPLCXNJOK-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|