C11H15N7O — CID 115669348
1-(2-amino-7H-purin-6-yl)piperidine-3-carboxamide (PubChem CID 115669348) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-(2-amino-7H-purin-6-yl)piperidine-3-carboxamide.
| Compound Name | 1-(2-amino-7H-purin-6-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 115669348 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-(2-amino-7H-purin-6-yl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2nc(N)nc3nc[nH]c23)C1 |
| InChI | InChI=1S/C11H15N7O/c12-8(19)6-2-1-3-18(4-6)10-7-9(15-5-14-7)16-11(13)17-10/h5-6H,1-4H2,(H2,12,19)(H3,13,14,15,16,17) |
| InChIKey | BUVIPKPLQKJDJQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |