C10H12N6 — CID 104623927
6-(3,6-dihydro-2H-pyridin-1-yl)-7H-purin-2-amine (PubChem CID 104623927) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-yl)-7H-purin-2-amine.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 104623927 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-7H-purin-2-amine |
| SMILES | Nc1nc(N2CC=CCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H12N6/c11-10-14-8-7(12-6-13-8)9(15-10)16-4-2-1-3-5-16/h1-2,6H,3-5H2,(H3,11,12,13,14,15) |
| InChIKey | FXFIYVVJAQFJDK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|