C11H13FN6 — CID 177211825
6-(6-fluoro-2-azaspiro[3.3]heptan-2-yl)-7H-purin-2-amine (PubChem CID 177211825) has the molecular formula C11H13FN6 and a molecular weight of 248.26 g/mol. Its IUPAC name is 6-(6-fluoro-2-azaspiro[3.3]heptan-2-yl)-7H-purin-2-amine.
| Compound Name | 6-(6-fluoro-2-azaspiro[3.3]heptan-2-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 177211825 |
| Molecular Formula | C11H13FN6 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 6-(6-fluoro-2-azaspiro[3.3]heptan-2-yl)-7H-purin-2-amine |
| SMILES | Nc1nc(N2CC3(CC(F)C3)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H13FN6/c12-6-1-11(2-6)3-18(4-11)9-7-8(15-5-14-7)16-10(13)17-9/h5-6H,1-4H2,(H3,13,14,15,16,17) |
| InChIKey | BFXQMMOXQJFYDX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |