C11H17N7O2S — CID 72881722
N-[1-(2-amino-7H-purin-6-yl)piperidin-4-yl]methanesulfonamide (PubChem CID 72881722) has the molecular formula C11H17N7O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is N-[1-(2-amino-7H-purin-6-yl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-(2-amino-7H-purin-6-yl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 72881722 |
| Molecular Formula | C11H17N7O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[1-(2-amino-7H-purin-6-yl)piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(c2nc(N)nc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C11H17N7O2S/c1-21(19,20)17-7-2-4-18(5-3-7)10-8-9(14-6-13-8)15-11(12)16-10/h6-7,17H,2-5H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | TYFMRCBONHGALT-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |