C12H17N7O — CID 103718742
1-(2-amino-7H-purin-6-yl)-N-methylpiperidine-3-carboxamide (PubChem CID 103718742) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is 1-(2-amino-7H-purin-6-yl)-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(2-amino-7H-purin-6-yl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 103718742 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(2-amino-7H-purin-6-yl)-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(c2nc(N)nc3nc[nH]c23)C1 |
| InChI | InChI=1S/C12H17N7O/c1-14-11(20)7-3-2-4-19(5-7)10-8-9(16-6-15-8)17-12(13)18-10/h6-7H,2-5H2,1H3,(H,14,20)(H3,13,15,16,17,18) |
| InChIKey | RTMKZAGFIVOLRN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |