C12H19N7 — CID 115669377
6-(4-propan-2-ylpiperazin-1-yl)-7H-purin-2-amine (PubChem CID 115669377) has the molecular formula C12H19N7 and a molecular weight of 261.33 g/mol. Its IUPAC name is 6-(4-propan-2-ylpiperazin-1-yl)-7H-purin-2-amine.
| Compound Name | 6-(4-propan-2-ylpiperazin-1-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 115669377 |
| Molecular Formula | C12H19N7 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6-(4-propan-2-ylpiperazin-1-yl)-7H-purin-2-amine |
| SMILES | CC(C)N1CCN(c2nc(N)nc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C12H19N7/c1-8(2)18-3-5-19(6-4-18)11-9-10(15-7-14-9)16-12(13)17-11/h7-8H,3-6H2,1-2H3,(H3,13,14,15,16,17) |
| InChIKey | NCRRQFONXWNKFJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |