C10H10N8 — CID 129275714
6-(methylideneamino)-N-(1-methylpyrazol-4-yl)-7H-purin-2-amine (PubChem CID 129275714) has the molecular formula C10H10N8 and a molecular weight of 242.25 g/mol. Its IUPAC name is 6-(methylideneamino)-N-(1-methylpyrazol-4-yl)-7H-purin-2-amine.
| Compound Name | 6-(methylideneamino)-N-(1-methylpyrazol-4-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 129275714 |
| Molecular Formula | C10H10N8 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 6-(methylideneamino)-N-(1-methylpyrazol-4-yl)-7H-purin-2-amine |
| SMILES | C=Nc1nc(Nc2cnn(C)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H10N8/c1-11-8-7-9(13-5-12-7)17-10(16-8)15-6-3-14-18(2)4-6/h3-5H,1H2,2H3,(H2,12,13,15,16,17) |
| InChIKey | HXVDTLVPDVGQJT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|