C13H15N7 — CID 164740937
6-cyclopropyl-N-(1,4-dimethylpyrazol-3-yl)-7H-purin-2-amine (PubChem CID 164740937) has the molecular formula C13H15N7 and a molecular weight of 269.31 g/mol. Its IUPAC name is 6-cyclopropyl-N-(1,4-dimethylpyrazol-3-yl)-7H-purin-2-amine.
| Compound Name | 6-cyclopropyl-N-(1,4-dimethylpyrazol-3-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 164740937 |
| Molecular Formula | C13H15N7 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-cyclopropyl-N-(1,4-dimethylpyrazol-3-yl)-7H-purin-2-amine |
| SMILES | Cc1cn(C)nc1Nc1nc(C2CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H15N7/c1-7-5-20(2)19-11(7)17-13-16-9(8-3-4-8)10-12(18-13)15-6-14-10/h5-6,8H,3-4H2,1-2H3,(H2,14,15,16,17,18,19) |
| InChIKey | SJIRHTWMQOTGOO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |