C16H19N7 — CID 140943276
6-cyclopropyl-N-[3-methyl-1-(1-methylcyclopropyl)pyrazol-4-yl]-7H-purin-2-amine (PubChem CID 140943276) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is 6-cyclopropyl-N-[3-methyl-1-(1-methylcyclopropyl)pyrazol-4-yl]-7H-purin-2-amine.
| Compound Name | 6-cyclopropyl-N-[3-methyl-1-(1-methylcyclopropyl)pyrazol-4-yl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 140943276 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 6-cyclopropyl-N-[3-methyl-1-(1-methylcyclopropyl)pyrazol-4-yl]-7H-purin-2-amine |
| SMILES | Cc1nn(C2(C)CC2)cc1Nc1nc(C2CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C16H19N7/c1-9-11(7-23(22-9)16(2)5-6-16)19-15-20-12(10-3-4-10)13-14(21-15)18-8-17-13/h7-8,10H,3-6H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | YQZLUSGLZOJDGD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |