C11H18N8 — CID 114785912
2-N-methyl-6-N-(4-methylpiperazin-1-yl)-7H-purine-2,6-diamine (PubChem CID 114785912) has the molecular formula C11H18N8 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-N-methyl-6-N-(4-methylpiperazin-1-yl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-methyl-6-N-(4-methylpiperazin-1-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785912 |
| Molecular Formula | C11H18N8 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-N-methyl-6-N-(4-methylpiperazin-1-yl)-7H-purine-2,6-diamine |
| SMILES | CNc1nc(NN2CCN(C)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H18N8/c1-12-11-15-9-8(13-7-14-9)10(16-11)17-19-5-3-18(2)4-6-19/h7H,3-6H2,1-2H3,(H3,12,13,14,15,16,17) |
| InChIKey | NKEORLGHVRZBQY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |