C12H19N5Sn — CID 170573572
5-methyl-N-(1-methylpyrazol-4-yl)-4-trimethylstannylpyrimidin-2-amine (PubChem CID 170573572) has the molecular formula C12H19N5Sn and a molecular weight of 352.03 g/mol. Its IUPAC name is 5-methyl-N-(1-methylpyrazol-4-yl)-4-trimethylstannylpyrimidin-2-amine.
| Compound Name | 5-methyl-N-(1-methylpyrazol-4-yl)-4-trimethylstannylpyrimidin-2-amine |
|---|---|
| PubChem CID | 170573572 |
| Molecular Formula | C12H19N5Sn |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 5-methyl-N-(1-methylpyrazol-4-yl)-4-trimethylstannylpyrimidin-2-amine |
| SMILES | Cc1cnc(Nc2cnn(C)c2)nc1[Sn](C)(C)C |
| InChI | InChI=1S/C9H10N5.3CH3.Sn/c1-7-3-10-9(11-4-7)13-8-5-12-14(2)6-8;;;;/h3,5-6H,1-2H3,(H,10,11,13);3*1H3; |
| InChIKey | UGPQMMVAOVNMIE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |